C14H19NSi — CID 147901630
trimethyl-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethynyl]silane (PubChem CID 147901630) has the molecular formula C14H19NSi and a molecular weight of 229.40 g/mol. Its IUPAC name is trimethyl-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethynyl]silane.
| Compound Name | trimethyl-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethynyl]silane |
|---|---|
| PubChem CID | 147901630 |
| Molecular Formula | C14H19NSi |
| Molecular Weight | 229.40 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | trimethyl-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C14H19NSi/c1-16(2,3)11-10-13-9-8-12-6-4-5-7-14(12)15-13/h8-9H,4-7H2,1-3H3 |
| InChIKey | IEJMMDDCTIWGKB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|