About 3-(aminodiazenyl)benzoic acid
3-(aminodiazenyl)benzoic acid (PubChem CID 147903566) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 3-(aminodiazenyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(aminodiazenyl)benzoic acid |
| PubChem CID | 147903566 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 3-(aminodiazenyl)benzoic acid |
| SMILES | N/N=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C7H7N3O2/c8-10-9-6-3-1-2-5(4-6)7(11)12/h1-4H,(H2,8,9)(H,11,12) |
| InChIKey | KBXUSWXSPCAIKU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminodiazenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminodiazenyl)benzoic acid?
The IUPAC name of 3-(aminodiazenyl)benzoic acid (CID 147903566) is 3-(aminodiazenyl)benzoic acid.
What is the SMILES notation for 3-(aminodiazenyl)benzoic acid?
The canonical SMILES for 3-(aminodiazenyl)benzoic acid is N/N=N/c1cccc(C(=O)O)c1.
What is the InChIKey of 3-(aminodiazenyl)benzoic acid?
The InChIKey is KBXUSWXSPCAIKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c8-10-9-6-3-1-2-5(4-6)7(11)12/h1-4H,(H2,8,9)(H,11,12).
What are the key properties of 3-(aminodiazenyl)benzoic acid?
3-(aminodiazenyl)benzoic acid has a molecular weight of 165.15 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminodiazenyl)benzoic acid is sourced from PubChem (CID 147903566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).