C18H23BN6O6 — CID 147904320
(3R)-3-[3-[4-[3-(diaminomethylideneamino)-2-hydroxypropyl]triazol-1-yl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 147904320) has the molecular formula C18H23BN6O6 and a molecular weight of 430.23 g/mol. Its IUPAC name is (3R)-3-[3-[4-[3-(diaminomethylideneamino)-2-hydroxypropyl]triazol-1-yl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[3-[4-[3-(diaminomethylideneamino)-2-hydroxypropyl]triazol-1-yl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 147904320 |
| Molecular Formula | C18H23BN6O6 |
| Molecular Weight | 430.23 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (3R)-3-[3-[4-[3-(diaminomethylideneamino)-2-hydroxypropyl]triazol-1-yl]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NC(N)=NCC(O)Cc1cn(CC(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)nn1 |
| InChI | InChI=1S/C18H23BN6O6/c20-18(21)22-7-13(26)6-12-8-25(24-23-12)9-14(27)5-11-4-10-2-1-3-15(17(28)29)16(10)31-19(11)30/h1-3,8,11,13,26,30H,4-7,9H2,(H,28,29)(H4,20,21,22)/t11-,13?/m1/s1 |
| InChIKey | IEWUDVHHLJRLQN-JTDNENJMSA-N |
| XLogP | -1.40 |
| TPSA | 199.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|