C16H22F2N2O — CID 147906104
(4aS,8aR)-2-(2,2-difluoroethyl)-4a,5,5,8a-tetramethyl-6-oxo-3,4-dihydro-1H-isoquinoline-7-carbonitrile (PubChem CID 147906104) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is (4aS,8aR)-2-(2,2-difluoroethyl)-4a,5,5,8a-tetramethyl-6-oxo-3,4-dihydro-1H-isoquinoline-7-carbonitrile.
| Compound Name | (4aS,8aR)-2-(2,2-difluoroethyl)-4a,5,5,8a-tetramethyl-6-oxo-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 147906104 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (4aS,8aR)-2-(2,2-difluoroethyl)-4a,5,5,8a-tetramethyl-6-oxo-3,4-dihydro-1H-isoquinoline-7-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@@]2(C)CN(CC(F)F)CC[C@]12C |
| InChI | InChI=1S/C16H22F2N2O/c1-14(2)13(21)11(8-19)7-15(3)10-20(9-12(17)18)6-5-16(14,15)4/h7,12H,5-6,9-10H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | IFFHNWVGSGJPMA-JKSUJKDBSA-N |
| XLogP | 3.03 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |