About 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine
2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine (PubChem CID 147909432) has the molecular formula C16H13N4+
and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine.
Molecular Properties
| Compound Name | 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine |
| PubChem CID | 147909432 |
| Molecular Formula | C16H13N4+ |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine |
| SMILES | NC1=NC(C2=[N+]=Cc3ccccc32)Nc2ccccc21 |
| InChI | InChI=1S/C16H13N4/c17-15-12-7-3-4-8-13(12)19-16(20-15)14-11-6-2-1-5-10(11)9-18-14/h1-9,16,19H,(H2,17,20)/q+1 |
| InChIKey | UMSHTLPOUILYPO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine?
The IUPAC name of 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine (CID 147909432) is 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine.
What is the SMILES notation for 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine?
The canonical SMILES for 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine is NC1=NC(C2=[N+]=Cc3ccccc32)Nc2ccccc21.
What is the InChIKey of 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine?
The InChIKey is UMSHTLPOUILYPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N4/c17-15-12-7-3-4-8-13(12)19-16(20-15)14-11-6-2-1-5-10(11)9-18-14/h1-9,16,19H,(H2,17,20)/q+1.
What are the key properties of 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine?
2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine has a molecular weight of 261.31 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isoindol-2-ium-1-yl-1,2-dihydroquinazolin-4-amine is sourced from PubChem (CID 147909432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).