C25H41N3O4 — CID 147910171
(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-(2-methylbut-3-yn-2-yl)piperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoic acid (PubChem CID 147910171) has the molecular formula C25H41N3O4 and a molecular weight of 447.62 g/mol. Its IUPAC name is (E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-(2-methylbut-3-yn-2-yl)piperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoic acid.
| Compound Name | (E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-(2-methylbut-3-yn-2-yl)piperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoic acid |
|---|---|
| PubChem CID | 147910171 |
| Molecular Formula | C25H41N3O4 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | (E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-(2-methylbut-3-yn-2-yl)piperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoic acid |
| SMILES | C#CC(C)(C)N1CCCC[C@@H]1C(=O)NC(C(=O)N(C)[C@H](/C=C(\C)C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C25H41N3O4/c1-10-25(7,8)28-14-12-11-13-19(28)22(29)26-21(17(4)5)23(30)27(9)20(16(2)3)15-18(6)24(31)32/h1,15-17,19-21H,11-14H2,2-9H3,(H,26,29)(H,31,32)/b18-15+/t19-,20-,21?/m1/s1 |
| InChIKey | IFYSNLMTVRWMOB-HOYIAKKRSA-N |
| XLogP | 2.91 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|