C7H13NO2 — CID 147910549
(1R,6S)-2-amino-6-methoxycyclohex-2-en-1-ol (PubChem CID 147910549) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (1R,6S)-2-amino-6-methoxycyclohex-2-en-1-ol.
| Compound Name | (1R,6S)-2-amino-6-methoxycyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 147910549 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (1R,6S)-2-amino-6-methoxycyclohex-2-en-1-ol |
| SMILES | CO[C@H]1CCC=C(N)[C@H]1O |
| InChI | InChI=1S/C7H13NO2/c1-10-6-4-2-3-5(8)7(6)9/h3,6-7,9H,2,4,8H2,1H3/t6-,7+/m0/s1 |
| InChIKey | IGARZMUKYNHJSF-NKWVEPMBSA-N |
| XLogP | -0.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |