About 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile
3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile (PubChem CID 147911086) has the molecular formula C10H15FN2O
and a molecular weight of 198.24 g/mol. Its IUPAC name is 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile.
Molecular Properties
| Compound Name | 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile |
| PubChem CID | 147911086 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile |
| SMILES | CC1(C)C[C@H](F)CN(C(=O)CC#N)C1 |
| InChI | InChI=1S/C10H15FN2O/c1-10(2)5-8(11)6-13(7-10)9(14)3-4-12/h8H,3,5-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | IGDKDMHYWVZKEO-QMMMGPOBSA-N |
| XLogP | 1.50 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile?
The IUPAC name of 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile (CID 147911086) is 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile.
What is the SMILES notation for 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile?
The canonical SMILES for 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile is CC1(C)C[C@H](F)CN(C(=O)CC#N)C1.
What is the InChIKey of 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile?
The InChIKey is IGDKDMHYWVZKEO-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H15FN2O/c1-10(2)5-8(11)6-13(7-10)9(14)3-4-12/h8H,3,5-7H2,1-2H3/t8-/m0/s1.
What are the key properties of 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile?
3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile has a molecular weight of 198.24 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5S)-5-fluoro-3,3-dimethylpiperidin-1-yl]-3-oxopropanenitrile is sourced from PubChem (CID 147911086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).