C11H23BO3 — CID 147911213
4,4,5,5-tetramethyl-2-pentoxy-1,3,2-dioxaborolane (PubChem CID 147911213) has the molecular formula C11H23BO3 and a molecular weight of 214.11 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-pentoxy-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-pentoxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 147911213 |
| Molecular Formula | C11H23BO3 |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-pentoxy-1,3,2-dioxaborolane |
| SMILES | CCCCCOB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H23BO3/c1-6-7-8-9-13-12-14-10(2,3)11(4,5)15-12/h6-9H2,1-5H3 |
| InChIKey | IGEAEAJIWNZUCW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|