C30H26Cl2O3 — CID 14791400
1-[2,2-dichloro-1,3-bis(4-methoxyphenyl)cyclopropyl]-4-phenylmethoxybenzene (PubChem CID 14791400) has the molecular formula C30H26Cl2O3 and a molecular weight of 505.44 g/mol. Its IUPAC name is 1-[2,2-dichloro-1,3-bis(4-methoxyphenyl)cyclopropyl]-4-phenylmethoxybenzene.
| Compound Name | 1-[2,2-dichloro-1,3-bis(4-methoxyphenyl)cyclopropyl]-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 14791400 |
| Molecular Formula | C30H26Cl2O3 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 1-[2,2-dichloro-1,3-bis(4-methoxyphenyl)cyclopropyl]-4-phenylmethoxybenzene |
| SMILES | COc1ccc(C2C(Cl)(Cl)C2(c2ccc(OC)cc2)c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H26Cl2O3/c1-33-25-14-8-22(9-15-25)28-29(30(28,31)32,23-10-16-26(34-2)17-11-23)24-12-18-27(19-13-24)35-20-21-6-4-3-5-7-21/h3-19,28H,20H2,1-2H3 |
| InChIKey | NOZGTIPFLLKLDR-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|