About 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol
7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol (PubChem CID 14791437) has the molecular formula C11H13ClO2
and a molecular weight of 212.68 g/mol. Its IUPAC name is 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol.
Molecular Properties
| Compound Name | 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol |
| PubChem CID | 14791437 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol |
| SMILES | CC1(C)CCc2cc(O)c(Cl)cc2O1 |
| InChI | InChI=1S/C11H13ClO2/c1-11(2)4-3-7-5-9(13)8(12)6-10(7)14-11/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | ZBXUQAKBWOKKCJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol?
The IUPAC name of 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol (CID 14791437) is 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol.
What is the SMILES notation for 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol?
The canonical SMILES for 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol is CC1(C)CCc2cc(O)c(Cl)cc2O1.
What is the InChIKey of 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol?
The InChIKey is ZBXUQAKBWOKKCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO2/c1-11(2)4-3-7-5-9(13)8(12)6-10(7)14-11/h5-6,13H,3-4H2,1-2H3.
What are the key properties of 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol?
7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol has a molecular weight of 212.68 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,2-dimethyl-3,4-dihydrochromen-6-ol is sourced from PubChem (CID 14791437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).