C21H16BrN3O2 — CID 147914533
6-bromo-N-(4-methoxy-7-phenyl-3H-indol-2-yl)pyridine-3-carboxamide (PubChem CID 147914533) has the molecular formula C21H16BrN3O2 and a molecular weight of 422.28 g/mol. Its IUPAC name is 6-bromo-N-(4-methoxy-7-phenyl-3H-indol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-(4-methoxy-7-phenyl-3H-indol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 147914533 |
| Molecular Formula | C21H16BrN3O2 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 6-bromo-N-(4-methoxy-7-phenyl-3H-indol-2-yl)pyridine-3-carboxamide |
| SMILES | COc1ccc(-c2ccccc2)c2c1CC(NC(=O)c1ccc(Br)nc1)=N2 |
| InChI | InChI=1S/C21H16BrN3O2/c1-27-17-9-8-15(13-5-3-2-4-6-13)20-16(17)11-19(24-20)25-21(26)14-7-10-18(22)23-12-14/h2-10,12H,11H2,1H3,(H,24,25,26) |
| InChIKey | IGUOPWLXYLXHHG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|