About (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine
(2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine (PubChem CID 14791975) has the molecular formula C24H26N2
and a molecular weight of 342.49 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine.
Molecular Properties
| Compound Name | (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine |
| PubChem CID | 14791975 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine |
| SMILES | C[C@@H](/C=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H26N2/c1-21(17-25-18-22-11-5-2-6-12-22)26(19-23-13-7-3-8-14-23)20-24-15-9-4-10-16-24/h2-17,21H,18-20H2,1H3/b25-17+/t21-/m0/s1 |
| InChIKey | QRVUTBGAPNXCPH-DIWDRYHZSA-N |
| XLogP | 5.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine?
The IUPAC name of (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine (CID 14791975) is (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine.
What is the SMILES notation for (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine?
The canonical SMILES for (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine is C[C@@H](/C=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine?
The InChIKey is QRVUTBGAPNXCPH-DIWDRYHZSA-N. The full InChI is InChI=1S/C24H26N2/c1-21(17-25-18-22-11-5-2-6-12-22)26(19-23-13-7-3-8-14-23)20-24-15-9-4-10-16-24/h2-17,21H,18-20H2,1H3/b25-17+/t21-/m0/s1.
What are the key properties of (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine?
(2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine has a molecular weight of 342.49 g/mol, XLogP of 5.35, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dibenzyl-1-benzyliminopropan-2-amine is sourced from PubChem (CID 14791975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).