About (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine
(2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine (PubChem CID 14791978) has the molecular formula C26H30N2
and a molecular weight of 370.54 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine.
Molecular Properties
| Compound Name | (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine |
| PubChem CID | 14791978 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine |
| SMILES | CC(C)[C@@H](/C=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H30N2/c1-22(2)26(19-27-18-23-12-6-3-7-13-23)28(20-24-14-8-4-9-15-24)21-25-16-10-5-11-17-25/h3-17,19,22,26H,18,20-21H2,1-2H3/b27-19+/t26-/m1/s1 |
| InChIKey | CVCJGOZNOGOEQX-KVYREEOHSA-N |
| XLogP | 5.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine?
The IUPAC name of (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine (CID 14791978) is (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine.
What is the SMILES notation for (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine?
The canonical SMILES for (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine is CC(C)[C@@H](/C=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine?
The InChIKey is CVCJGOZNOGOEQX-KVYREEOHSA-N. The full InChI is InChI=1S/C26H30N2/c1-22(2)26(19-27-18-23-12-6-3-7-13-23)28(20-24-14-8-4-9-15-24)21-25-16-10-5-11-17-25/h3-17,19,22,26H,18,20-21H2,1-2H3/b27-19+/t26-/m1/s1.
What are the key properties of (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine?
(2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine has a molecular weight of 370.54 g/mol, XLogP of 5.98, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dibenzyl-1-benzylimino-3-methylbutan-2-amine is sourced from PubChem (CID 14791978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).