C13H10F3NO5S — CID 147920349
(1,3-dioxo-3a,4,5,6-tetrahydrobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 147920349) has the molecular formula C13H10F3NO5S and a molecular weight of 349.29 g/mol. Its IUPAC name is (1,3-dioxo-3a,4,5,6-tetrahydrobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | (1,3-dioxo-3a,4,5,6-tetrahydrobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 147920349 |
| Molecular Formula | C13H10F3NO5S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | (1,3-dioxo-3a,4,5,6-tetrahydrobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2cccc3c2C(CCC3)C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO5S/c14-13(15,16)23(20,21)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19/h1,3,5,9H,2,4,6H2 |
| InChIKey | KIAYQAHRWQTIRN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|