About 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione
6,7-dimethoxy-2,2-dimethylchromene-5,8-dione (PubChem CID 14792456) has the molecular formula C13H14O5
and a molecular weight of 250.25 g/mol. Its IUPAC name is 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione |
| PubChem CID | 14792456 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione |
| SMILES | COC1=C(OC)C(=O)C2=C(C=CC(C)(C)O2)C1=O |
| InChI | InChI=1S/C13H14O5/c1-13(2)6-5-7-8(14)11(16-3)12(17-4)9(15)10(7)18-13/h5-6H,1-4H3 |
| InChIKey | LEJPEBSHNVQVPO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione?
The IUPAC name of 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione (CID 14792456) is 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione.
What is the SMILES notation for 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione?
The canonical SMILES for 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione is COC1=C(OC)C(=O)C2=C(C=CC(C)(C)O2)C1=O.
What is the InChIKey of 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione?
The InChIKey is LEJPEBSHNVQVPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5/c1-13(2)6-5-7-8(14)11(16-3)12(17-4)9(15)10(7)18-13/h5-6H,1-4H3.
What are the key properties of 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione?
6,7-dimethoxy-2,2-dimethylchromene-5,8-dione has a molecular weight of 250.25 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2,2-dimethylchromene-5,8-dione is sourced from PubChem (CID 14792456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).