About N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine
N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine (PubChem CID 147926584) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 147926584 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine |
| SMILES | C1=CCCC(NC2C=CCCC2)=C1 |
| InChI | InChI=1S/C12H17N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3,5,7,9,12-13H,2,4,6,8,10H2 |
| InChIKey | IJAQUMKHSNOHEH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine?
The IUPAC name of N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine (CID 147926584) is N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine is C1=CCCC(NC2C=CCCC2)=C1.
What is the InChIKey of N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine?
The InChIKey is IJAQUMKHSNOHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3,5,7,9,12-13H,2,4,6,8,10H2.
What are the key properties of N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine?
N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine has a molecular weight of 175.28 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 147926584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).