About 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one
3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 1479284) has the molecular formula C14H15NO3S
and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one |
| PubChem CID | 1479284 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H15NO3S/c1-10-8-11(2)15-14(16)13(10)19(17,18)9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,15,16) |
| InChIKey | NJCSDSCOEVVWPF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one?
The IUPAC name of 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one (CID 1479284) is 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one is Cc1cc(C)c(S(=O)(=O)Cc2ccccc2)c(=O)[nH]1.
What is the InChIKey of 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one?
The InChIKey is NJCSDSCOEVVWPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3S/c1-10-8-11(2)15-14(16)13(10)19(17,18)9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,15,16).
What are the key properties of 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one?
3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one has a molecular weight of 277.34 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfonyl-4,6-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 1479284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).