C35H55N3O7S — CID 147928740
tert-butyl (3S)-3-[(5R,8S)-8-[2-[(1R,2S)-2-ethenyl-1-(pyrrolidin-1-ylsulfonylcarbamoyl)cyclopropyl]acetyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoate (PubChem CID 147928740) has the molecular formula C35H55N3O7S and a molecular weight of 661.91 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(5R,8S)-8-[2-[(1R,2S)-2-ethenyl-1-(pyrrolidin-1-ylsulfonylcarbamoyl)cyclopropyl]acetyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoate.
| Compound Name | tert-butyl (3S)-3-[(5R,8S)-8-[2-[(1R,2S)-2-ethenyl-1-(pyrrolidin-1-ylsulfonylcarbamoyl)cyclopropyl]acetyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 147928740 |
| Molecular Formula | C35H55N3O7S |
| Molecular Weight | 661.91 g/mol |
| Exact Mass | 661.38 |
| IUPAC Name | tert-butyl (3S)-3-[(5R,8S)-8-[2-[(1R,2S)-2-ethenyl-1-(pyrrolidin-1-ylsulfonylcarbamoyl)cyclopropyl]acetyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoate |
| SMILES | C=C[C@@H]1C[C@]1(CC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](CC(=O)OC(C)(C)C)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C35H55N3O7S/c1-10-23-19-33(23,29(42)36-46(43,44)37-16-11-12-17-37)21-26(39)25-20-35(32(8,9)34(35)14-13-15-34)22-38(25)28(41)24(30(2,3)4)18-27(40)45-31(5,6)7/h10,23-25H,1,11-22H2,2-9H3,(H,36,42)/t23-,24-,25+,33-,35-/m1/s1 |
| InChIKey | IJLGKMMPTBSMDA-GHTTYEJASA-N |
| XLogP | 4.79 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|