C8H14N2O4 — CID 14793294
1,7-dioxa-4,10-diazacyclododecane-3,11-dione (PubChem CID 14793294) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1,7-dioxa-4,10-diazacyclododecane-3,11-dione.
| Compound Name | 1,7-dioxa-4,10-diazacyclododecane-3,11-dione |
|---|---|
| PubChem CID | 14793294 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,7-dioxa-4,10-diazacyclododecane-3,11-dione |
| SMILES | O=C1COCC(=O)NCCOCCN1 |
| InChI | InChI=1S/C8H14N2O4/c11-7-5-14-6-8(12)10-2-4-13-3-1-9-7/h1-6H2,(H,9,11)(H,10,12) |
| InChIKey | XEURKMXZTFELEI-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |