C24H24ClFN2O3 — CID 147934466
3-[4-chloro-5-(4-fluorophenyl)-2-hydroxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one (PubChem CID 147934466) has the molecular formula C24H24ClFN2O3 and a molecular weight of 442.92 g/mol. Its IUPAC name is 3-[4-chloro-5-(4-fluorophenyl)-2-hydroxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one.
| Compound Name | 3-[4-chloro-5-(4-fluorophenyl)-2-hydroxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 147934466 |
| Molecular Formula | C24H24ClFN2O3 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-[4-chloro-5-(4-fluorophenyl)-2-hydroxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one |
| SMILES | C=CC(=O)N1CC2CN(C(=O)CCc3cc(-c4ccc(F)cc4)c(Cl)cc3O)CC2C1 |
| InChI | InChI=1S/C24H24ClFN2O3/c1-2-23(30)27-11-17-13-28(14-18(17)12-27)24(31)8-5-16-9-20(21(25)10-22(16)29)15-3-6-19(26)7-4-15/h2-4,6-7,9-10,17-18,29H,1,5,8,11-14H2 |
| InChIKey | IKNFRHUAVKVGIV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|