About dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride
dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride (PubChem CID 14793735) has the molecular formula C16H18Cl3N3OZn
and a molecular weight of 440.09 g/mol. Its IUPAC name is dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride.
Molecular Properties
| Compound Name | dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride |
| PubChem CID | 14793735 |
| Molecular Formula | C16H18Cl3N3OZn |
| Molecular Weight | 440.09 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride |
| SMILES | CN(C)c1ccc2nc3ccc(=[N+](C)C)cc-3oc2c1.Cl[Zn]Cl.[Cl-] |
| InChI | InChI=1S/C16H18N3O.3ClH.Zn/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;;;/h5-10H,1-4H3;3*1H;/q+1;;;;+2/p-3 |
| InChIKey | UNIXSDSNQIVOEI-UHFFFAOYSA-K |
| XLogP | 0.41 |
| TPSA | 32.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.09 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride?
The IUPAC name of dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride (CID 14793735) is dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride.
What is the SMILES notation for dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride?
The canonical SMILES for dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride is CN(C)c1ccc2nc3ccc(=[N+](C)C)cc-3oc2c1.Cl[Zn]Cl.[Cl-].
What is the InChIKey of dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride?
The InChIKey is UNIXSDSNQIVOEI-UHFFFAOYSA-K. The full InChI is InChI=1S/C16H18N3O.3ClH.Zn/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;;;/h5-10H,1-4H3;3*1H;/q+1;;;;+2/p-3.
What are the key properties of dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride?
dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride has a molecular weight of 440.09 g/mol, XLogP of 0.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;[7-(dimethylamino)phenoxazin-3-ylidene]-dimethylazanium;chloride is sourced from PubChem (CID 14793735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).