C17H14Cl2N4S2 — CID 1479377
(7S,7aS)-3,7-bis(4-chlorophenyl)-7-methyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione (PubChem CID 1479377) has the molecular formula C17H14Cl2N4S2 and a molecular weight of 409.37 g/mol. Its IUPAC name is (7S,7aS)-3,7-bis(4-chlorophenyl)-7-methyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione.
| Compound Name | (7S,7aS)-3,7-bis(4-chlorophenyl)-7-methyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione |
|---|---|
| PubChem CID | 1479377 |
| Molecular Formula | C17H14Cl2N4S2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | (7S,7aS)-3,7-bis(4-chlorophenyl)-7-methyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione |
| SMILES | C[C@@]1(c2ccc(Cl)cc2)NC(=S)N2[C@@H]1NC(=S)N2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N4S2/c1-17(10-2-4-11(18)5-3-10)14-20-15(24)22(23(14)16(25)21-17)13-8-6-12(19)7-9-13/h2-9,14H,1H3,(H,20,24)(H,21,25)/t14-,17-/m0/s1 |
| InChIKey | CEEKAUKKCDPUKD-YOEHRIQHSA-N |
| XLogP | 4.03 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|