C21H19N3O — CID 14793803
1,3,3-trimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] (PubChem CID 14793803) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 1,3,3-trimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine].
| Compound Name | 1,3,3-trimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] |
|---|---|
| PubChem CID | 14793803 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1,3,3-trimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Nc1c(ccc3ccncc13)O2 |
| InChI | InChI=1S/C21H19N3O/c1-20(2)16-6-4-5-7-17(16)24(3)21(20)13-23-19-15-12-22-11-10-14(15)8-9-18(19)25-21/h4-13H,1-3H3 |
| InChIKey | YNHKRBMTXDETNR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |