C17H22ClF3N5O8PS — CID 147938657
[1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2,2,2-trifluoroethyl]phosphonic acid (PubChem CID 147938657) has the molecular formula C17H22ClF3N5O8PS and a molecular weight of 579.88 g/mol. Its IUPAC name is [1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2,2,2-trifluoroethyl]phosphonic acid.
| Compound Name | [1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2,2,2-trifluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 147938657 |
| Molecular Formula | C17H22ClF3N5O8PS |
| Molecular Weight | 579.88 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | [1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2,2,2-trifluoroethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(C(F)(F)F)S(=O)(=O)C[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H22ClF3N5O8PS/c18-10-5-8(22-7-3-1-2-4-7)11-14(23-10)26(25-24-11)15-13(28)12(27)9(34-15)6-36(32,33)16(17(19,20)21)35(29,30)31/h5,7,9,12-13,15-16,27-28H,1-4,6H2,(H,22,23)(H2,29,30,31)/t9-,12-,13-,15-,16?/m1/s1 |
| InChIKey | ILHMFALSSAMWGC-PRMKKCFUSA-N |
| XLogP | 0.93 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.88 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|