C11H11NO3S — CID 1479389
2-[(2R)-5-oxopyrrolidin-2-yl]sulfanylbenzoic acid (PubChem CID 1479389) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-[(2R)-5-oxopyrrolidin-2-yl]sulfanylbenzoic acid.
| Compound Name | 2-[(2R)-5-oxopyrrolidin-2-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 1479389 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-[(2R)-5-oxopyrrolidin-2-yl]sulfanylbenzoic acid |
| SMILES | O=C1CC[C@@H](Sc2ccccc2C(=O)O)N1 |
| InChI | InChI=1S/C11H11NO3S/c13-9-5-6-10(12-9)16-8-4-2-1-3-7(8)11(14)15/h1-4,10H,5-6H2,(H,12,13)(H,14,15)/t10-/m1/s1 |
| InChIKey | DGACLTJLEOQYAX-SNVBAGLBSA-N |
| XLogP | 1.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |