C15H18F12O2 — CID 147941036
(Z)-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-3,7-bis(2,2,2-trifluoroethyl)non-4-ene (PubChem CID 147941036) has the molecular formula C15H18F12O2 and a molecular weight of 458.28 g/mol. Its IUPAC name is (Z)-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-3,7-bis(2,2,2-trifluoroethyl)non-4-ene.
| Compound Name | (Z)-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-3,7-bis(2,2,2-trifluoroethyl)non-4-ene |
|---|---|
| PubChem CID | 147941036 |
| Molecular Formula | C15H18F12O2 |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (Z)-1,1,1,9,9,9-hexafluoro-4,6-dimethoxy-3,7-bis(2,2,2-trifluoroethyl)non-4-ene |
| SMILES | CO/C(=C\C(OC)C(CC(F)(F)F)CC(F)(F)F)C(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C15H18F12O2/c1-28-10(8(4-12(16,17)18)5-13(19,20)21)3-11(29-2)9(6-14(22,23)24)7-15(25,26)27/h3,8-10H,4-7H2,1-2H3/b11-3- |
| InChIKey | ILTIPMDHMNVJCJ-JYOAFUTRSA-N |
| XLogP | 6.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|