C14H4F6O6 — CID 14794191
4,8-bis(2,2,2-trifluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 14794191) has the molecular formula C14H4F6O6 and a molecular weight of 382.17 g/mol. Its IUPAC name is 4,8-bis(2,2,2-trifluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4,8-bis(2,2,2-trifluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 14794191 |
| Molecular Formula | C14H4F6O6 |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 4,8-bis(2,2,2-trifluoroethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=c1oc(=O)c2c(CC(F)(F)F)c3c(=O)oc(=O)c3c(CC(F)(F)F)c12 |
| InChI | InChI=1S/C14H4F6O6/c15-13(16,17)1-3-5-7(11(23)25-9(5)21)4(2-14(18,19)20)8-6(3)10(22)26-12(8)24/h1-2H2 |
| InChIKey | KXVGHHWIQPWIDB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |