C14H28BN3O5 — CID 147944218
(2S,3R,4R)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid (PubChem CID 147944218) has the molecular formula C14H28BN3O5 and a molecular weight of 329.21 g/mol. Its IUPAC name is (2S,3R,4R)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 147944218 |
| Molecular Formula | C14H28BN3O5 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (2S,3R,4R)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)[C@H](N)C(=O)N[C@H]1CN[C@H](C(=O)O)[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C14H28BN3O5/c1-14(2,3)11(16)12(19)18-9-7-17-10(13(20)21)8(9)5-4-6-15(22)23/h8-11,17,22-23H,4-7,16H2,1-3H3,(H,18,19)(H,20,21)/t8-,9+,10+,11-/m1/s1 |
| InChIKey | IMIQJHHIHJHTTL-VPOLOUISSA-N |
| XLogP | -1.23 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|