About [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate
[4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate (PubChem CID 14794456) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate.
Molecular Properties
| Compound Name | [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate |
| PubChem CID | 14794456 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)C)cc(O)c(C)c1C(C)C |
| InChI | InChI=1S/C15H22O3/c1-8(2)12-7-13(17)10(5)14(9(3)4)15(12)18-11(6)16/h7-9,17H,1-6H3 |
| InChIKey | GZVNJURZHHJNLS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate?
The IUPAC name of [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate (CID 14794456) is [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate.
What is the SMILES notation for [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate?
The canonical SMILES for [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate is CC(=O)Oc1c(C(C)C)cc(O)c(C)c1C(C)C.
What is the InChIKey of [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate?
The InChIKey is GZVNJURZHHJNLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-8(2)12-7-13(17)10(5)14(9(3)4)15(12)18-11(6)16/h7-9,17H,1-6H3.
What are the key properties of [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate?
[4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate has a molecular weight of 250.34 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-hydroxy-3-methyl-2,6-di(propan-2-yl)phenyl] acetate is sourced from PubChem (CID 14794456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).