C18H14Cl2N2O2S2 — CID 1479463
4-(4-chlorophenyl)sulfanyl-6-[(4-chlorophenyl)sulfonylmethyl]-2-methylpyrimidine (PubChem CID 1479463) has the molecular formula C18H14Cl2N2O2S2 and a molecular weight of 425.36 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-6-[(4-chlorophenyl)sulfonylmethyl]-2-methylpyrimidine.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-6-[(4-chlorophenyl)sulfonylmethyl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 1479463 |
| Molecular Formula | C18H14Cl2N2O2S2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-6-[(4-chlorophenyl)sulfonylmethyl]-2-methylpyrimidine |
| SMILES | Cc1nc(CS(=O)(=O)c2ccc(Cl)cc2)cc(Sc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H14Cl2N2O2S2/c1-12-21-15(11-26(23,24)17-8-4-14(20)5-9-17)10-18(22-12)25-16-6-2-13(19)3-7-16/h2-10H,11H2,1H3 |
| InChIKey | HWFDRXOBISZWAO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |