C34H42N8O3 — CID 147949588
1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[9-(oxetan-3-yl)-3,9-diazaspiro[5.5]undecan-3-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 147949588) has the molecular formula C34H42N8O3 and a molecular weight of 610.76 g/mol. Its IUPAC name is 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[9-(oxetan-3-yl)-3,9-diazaspiro[5.5]undecan-3-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[9-(oxetan-3-yl)-3,9-diazaspiro[5.5]undecan-3-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 147949588 |
| Molecular Formula | C34H42N8O3 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[9-(oxetan-3-yl)-3,9-diazaspiro[5.5]undecan-3-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC5(CC4)CCN(C4COC4)CC5)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C34H42N8O3/c1-4-16-41-31(43)27-21-35-32(38-30(27)42(41)29-7-5-6-28(37-29)33(2,3)44)36-24-8-10-25(11-9-24)39-17-12-34(13-18-39)14-19-40(20-15-34)26-22-45-23-26/h4-11,21,26,44H,1,12-20,22-23H2,2-3H3,(H,35,36,38) |
| InChIKey | INIWJFNVTACZJL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|