C21H32O7 — CID 147951913
[(2R,5S)-5-hydroxy-2-[(S)-hydroxy-[(2R,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-4-methylidene-3,7-dioxononyl] acetate (PubChem CID 147951913) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is [(2R,5S)-5-hydroxy-2-[(S)-hydroxy-[(2R,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-4-methylidene-3,7-dioxononyl] acetate.
| Compound Name | [(2R,5S)-5-hydroxy-2-[(S)-hydroxy-[(2R,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-4-methylidene-3,7-dioxononyl] acetate |
|---|---|
| PubChem CID | 147951913 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | [(2R,5S)-5-hydroxy-2-[(S)-hydroxy-[(2R,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-4-methylidene-3,7-dioxononyl] acetate |
| SMILES | C=C(C(=O)[C@H](COC(C)=O)[C@H](O)[C@@]1(C)O[C@@H]1[C@@H](C)/C=C\C)[C@@H](O)CC(=O)CC |
| InChI | InChI=1S/C21H32O7/c1-7-9-12(3)20-21(6,28-20)19(26)16(11-27-14(5)22)18(25)13(4)17(24)10-15(23)8-2/h7,9,12,16-17,19-20,24,26H,4,8,10-11H2,1-3,5-6H3/b9-7-/t12-,16-,17-,19-,20+,21+/m0/s1 |
| InChIKey | INTXVVAAMVADFD-YLZVMCIXSA-N |
| XLogP | 1.75 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|