About 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one
6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one (PubChem CID 14795227) has the molecular formula C11H15BrO
and a molecular weight of 243.14 g/mol. Its IUPAC name is 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one.
Molecular Properties
| Compound Name | 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one |
| PubChem CID | 14795227 |
| Molecular Formula | C11H15BrO |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one |
| SMILES | O=C(CCCCCBr)C1=CC=CC1 |
| InChI | InChI=1S/C11H15BrO/c12-9-5-1-2-8-11(13)10-6-3-4-7-10/h3-4,6H,1-2,5,7-9H2 |
| InChIKey | OZHZCANYRCCBND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one?
The IUPAC name of 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one (CID 14795227) is 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one.
What is the SMILES notation for 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one?
The canonical SMILES for 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one is O=C(CCCCCBr)C1=CC=CC1.
What is the InChIKey of 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one?
The InChIKey is OZHZCANYRCCBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO/c12-9-5-1-2-8-11(13)10-6-3-4-7-10/h3-4,6H,1-2,5,7-9H2.
What are the key properties of 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one?
6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one has a molecular weight of 243.14 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-cyclopenta-1,3-dien-1-ylhexan-1-one is sourced from PubChem (CID 14795227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).