About 2-sulfanylbenzene-1,3,5-tricarbonitrile
2-sulfanylbenzene-1,3,5-tricarbonitrile (PubChem CID 14795337) has the molecular formula C9H3N3S
and a molecular weight of 185.21 g/mol. Its IUPAC name is 2-sulfanylbenzene-1,3,5-tricarbonitrile.
Molecular Properties
| Compound Name | 2-sulfanylbenzene-1,3,5-tricarbonitrile |
| PubChem CID | 14795337 |
| Molecular Formula | C9H3N3S |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 2-sulfanylbenzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(S)c(C#N)c1 |
| InChI | InChI=1S/C9H3N3S/c10-3-6-1-7(4-11)9(13)8(2-6)5-12/h1-2,13H |
| InChIKey | WPCCQPZWKCHMGT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylbenzene-1,3,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylbenzene-1,3,5-tricarbonitrile?
The IUPAC name of 2-sulfanylbenzene-1,3,5-tricarbonitrile (CID 14795337) is 2-sulfanylbenzene-1,3,5-tricarbonitrile.
What is the SMILES notation for 2-sulfanylbenzene-1,3,5-tricarbonitrile?
The canonical SMILES for 2-sulfanylbenzene-1,3,5-tricarbonitrile is N#Cc1cc(C#N)c(S)c(C#N)c1.
What is the InChIKey of 2-sulfanylbenzene-1,3,5-tricarbonitrile?
The InChIKey is WPCCQPZWKCHMGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3N3S/c10-3-6-1-7(4-11)9(13)8(2-6)5-12/h1-2,13H.
What are the key properties of 2-sulfanylbenzene-1,3,5-tricarbonitrile?
2-sulfanylbenzene-1,3,5-tricarbonitrile has a molecular weight of 185.21 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylbenzene-1,3,5-tricarbonitrile is sourced from PubChem (CID 14795337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).