About ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate
ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate (PubChem CID 1479536) has the molecular formula C18H16Cl2N4O4
and a molecular weight of 423.26 g/mol. Its IUPAC name is ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate |
| PubChem CID | 1479536 |
| Molecular Formula | C18H16Cl2N4O4 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(-n2nnnc2-c2ccc(OC)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N4O4/c1-3-27-17(25)10-28-16-9-15(13(19)8-14(16)20)24-18(21-22-23-24)11-4-6-12(26-2)7-5-11/h4-9H,3,10H2,1-2H3 |
| InChIKey | FFAJWUBOAIMGFT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate?
The IUPAC name of ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate (CID 1479536) is ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate.
What is the SMILES notation for ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate?
The canonical SMILES for ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate is CCOC(=O)COc1cc(-n2nnnc2-c2ccc(OC)cc2)c(Cl)cc1Cl.
What is the InChIKey of ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate?
The InChIKey is FFAJWUBOAIMGFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N4O4/c1-3-27-17(25)10-28-16-9-15(13(19)8-14(16)20)24-18(21-22-23-24)11-4-6-12(26-2)7-5-11/h4-9H,3,10H2,1-2H3.
What are the key properties of ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate?
ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate has a molecular weight of 423.26 g/mol, XLogP of 3.59, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2,4-dichloro-5-[5-(4-methoxyphenyl)tetrazol-1-yl]phenoxy]acetate is sourced from PubChem (CID 1479536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).