C19H18F6O6S2 — CID 14795361
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-[3,5-bis(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate (PubChem CID 14795361) has the molecular formula C19H18F6O6S2 and a molecular weight of 520.47 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[3,5-bis(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[3,5-bis(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate |
|---|---|
| PubChem CID | 14795361 |
| Molecular Formula | C19H18F6O6S2 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[3,5-bis(trifluoromethyl)phenyl]sulfanylthian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Sc2cc(C(F)(F)F)cc(C(F)(F)F)c2)SC[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H18F6O6S2/c1-8(26)29-14-7-32-17(16(31-10(3)28)15(14)30-9(2)27)33-13-5-11(18(20,21)22)4-12(6-13)19(23,24)25/h4-6,14-17H,7H2,1-3H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | CFNXREPFRIXMRV-TWMKSMIVSA-N |
| XLogP | 4.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|