About S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate
S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 14795409) has the molecular formula C11H9F6NOS
and a molecular weight of 317.25 g/mol. Its IUPAC name is S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate |
| PubChem CID | 14795409 |
| Molecular Formula | C11H9F6NOS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F6NOS/c1-18(2)9(19)20-8-4-6(10(12,13)14)3-7(5-8)11(15,16)17/h3-5H,1-2H3 |
| InChIKey | HDDBEGOLJSUBCV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate?
The IUPAC name of S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate (CID 14795409) is S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate.
What is the SMILES notation for S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate?
The canonical SMILES for S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate is CN(C)C(=O)Sc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate?
The InChIKey is HDDBEGOLJSUBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F6NOS/c1-18(2)9(19)20-8-4-6(10(12,13)14)3-7(5-8)11(15,16)17/h3-5H,1-2H3.
What are the key properties of S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate?
S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate has a molecular weight of 317.25 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3,5-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 14795409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).