C18H15N3O — CID 147954464
1-[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]pent-3-yn-2-one (PubChem CID 147954464) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]pent-3-yn-2-one.
| Compound Name | 1-[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]pent-3-yn-2-one |
|---|---|
| PubChem CID | 147954464 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]pent-3-yn-2-one |
| SMILES | CC#CC(=O)Cc1cc2cc(-c3cnn(C)c3)ccc2cn1 |
| InChI | InChI=1S/C18H15N3O/c1-3-4-18(22)9-17-8-15-7-13(5-6-14(15)10-19-17)16-11-20-21(2)12-16/h5-8,10-12H,9H2,1-2H3 |
| InChIKey | IOGKCGKJVRCBCW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|