About 6-fluoro-2-propoxy-1,3-benzothiazole
6-fluoro-2-propoxy-1,3-benzothiazole (PubChem CID 14795456) has the molecular formula C10H10FNOS
and a molecular weight of 211.26 g/mol. Its IUPAC name is 6-fluoro-2-propoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-fluoro-2-propoxy-1,3-benzothiazole |
| PubChem CID | 14795456 |
| Molecular Formula | C10H10FNOS |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 6-fluoro-2-propoxy-1,3-benzothiazole |
| SMILES | CCCOc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C10H10FNOS/c1-2-5-13-10-12-8-4-3-7(11)6-9(8)14-10/h3-4,6H,2,5H2,1H3 |
| InChIKey | BDKNVXJVRQTNCW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-2-propoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-propoxy-1,3-benzothiazole?
The IUPAC name of 6-fluoro-2-propoxy-1,3-benzothiazole (CID 14795456) is 6-fluoro-2-propoxy-1,3-benzothiazole.
What is the SMILES notation for 6-fluoro-2-propoxy-1,3-benzothiazole?
The canonical SMILES for 6-fluoro-2-propoxy-1,3-benzothiazole is CCCOc1nc2ccc(F)cc2s1.
What is the InChIKey of 6-fluoro-2-propoxy-1,3-benzothiazole?
The InChIKey is BDKNVXJVRQTNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNOS/c1-2-5-13-10-12-8-4-3-7(11)6-9(8)14-10/h3-4,6H,2,5H2,1H3.
What are the key properties of 6-fluoro-2-propoxy-1,3-benzothiazole?
6-fluoro-2-propoxy-1,3-benzothiazole has a molecular weight of 211.26 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-propoxy-1,3-benzothiazole is sourced from PubChem (CID 14795456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).