About 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine
2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine (PubChem CID 147958353) has the molecular formula C30H21N5O
and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine.
Molecular Properties
| Compound Name | 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine |
| PubChem CID | 147958353 |
| Molecular Formula | C30H21N5O |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine |
| SMILES | c1ccc(C2(c3cccc(Oc4ccn(-n5cncn5)c4)c3)c3ccccc3-c3ccccc32)nc1 |
| InChI | InChI=1S/C30H21N5O/c1-3-12-27-25(10-1)26-11-2-4-13-28(26)30(27,29-14-5-6-16-32-29)22-8-7-9-23(18-22)36-24-15-17-34(19-24)35-21-31-20-33-35/h1-21H |
| InChIKey | IOZHXQYJLXGJJL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine?
The IUPAC name of 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine (CID 147958353) is 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine.
What is the SMILES notation for 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine?
The canonical SMILES for 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine is c1ccc(C2(c3cccc(Oc4ccn(-n5cncn5)c4)c3)c3ccccc3-c3ccccc32)nc1.
What is the InChIKey of 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine?
The InChIKey is IOZHXQYJLXGJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21N5O/c1-3-12-27-25(10-1)26-11-2-4-13-28(26)30(27,29-14-5-6-16-32-29)22-8-7-9-23(18-22)36-24-15-17-34(19-24)35-21-31-20-33-35/h1-21H.
What are the key properties of 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine?
2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine has a molecular weight of 467.53 g/mol, XLogP of 5.94, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-[3-[1-(1,2,4-triazol-1-yl)pyrrol-3-yl]oxyphenyl]fluoren-9-yl]pyridine is sourced from PubChem (CID 147958353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).