About 4-fluoro-2,3-dihydro-1H-isoindole
4-fluoro-2,3-dihydro-1H-isoindole (PubChem CID 14795867) has the molecular formula C8H8FN
and a molecular weight of 137.16 g/mol. Its IUPAC name is 4-fluoro-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 4-fluoro-2,3-dihydro-1H-isoindole |
| PubChem CID | 14795867 |
| Molecular Formula | C8H8FN |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 4-fluoro-2,3-dihydro-1H-isoindole |
| SMILES | Fc1cccc2c1CNC2 |
| InChI | InChI=1S/C8H8FN/c9-8-3-1-2-6-4-10-5-7(6)8/h1-3,10H,4-5H2 |
| InChIKey | UDBMWFNXDSVYBR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,3-dihydro-1H-isoindole?
The IUPAC name of 4-fluoro-2,3-dihydro-1H-isoindole (CID 14795867) is 4-fluoro-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 4-fluoro-2,3-dihydro-1H-isoindole?
The canonical SMILES for 4-fluoro-2,3-dihydro-1H-isoindole is Fc1cccc2c1CNC2.
What is the InChIKey of 4-fluoro-2,3-dihydro-1H-isoindole?
The InChIKey is UDBMWFNXDSVYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN/c9-8-3-1-2-6-4-10-5-7(6)8/h1-3,10H,4-5H2.
What are the key properties of 4-fluoro-2,3-dihydro-1H-isoindole?
4-fluoro-2,3-dihydro-1H-isoindole has a molecular weight of 137.16 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 14795867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).