C21H25N5O4 — CID 14796339
(Z)-but-2-enedioic acid;N',N'-dimethyl-N-[4-(1-methylpyrazolo[5,4-b]pyridin-3-yl)phenyl]ethane-1,2-diamine (PubChem CID 14796339) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N',N'-dimethyl-N-[4-(1-methylpyrazolo[5,4-b]pyridin-3-yl)phenyl]ethane-1,2-diamine.
| Compound Name | (Z)-but-2-enedioic acid;N',N'-dimethyl-N-[4-(1-methylpyrazolo[5,4-b]pyridin-3-yl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 14796339 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;N',N'-dimethyl-N-[4-(1-methylpyrazolo[5,4-b]pyridin-3-yl)phenyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNc1ccc(-c2nn(C)c3ncccc23)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H21N5.C4H4O4/c1-21(2)12-11-18-14-8-6-13(7-9-14)16-15-5-4-10-19-17(15)22(3)20-16;5-3(6)1-2-4(7)8/h4-10,18H,11-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ZLMUWOMRFZWQSK-BTJKTKAUSA-N |
| XLogP | 2.32 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|