About 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole
5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole (PubChem CID 1479634) has the molecular formula C13H10N2OS
and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole |
| PubChem CID | 1479634 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole |
| SMILES | Cc1oncc1-c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H10N2OS/c1-9-11(7-14-16-9)12-8-17-13(15-12)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | DXNKVFULNYRCOG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole?
The IUPAC name of 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole (CID 1479634) is 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole.
What is the SMILES notation for 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole?
The canonical SMILES for 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole is Cc1oncc1-c1csc(-c2ccccc2)n1.
What is the InChIKey of 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole?
The InChIKey is DXNKVFULNYRCOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2OS/c1-9-11(7-14-16-9)12-8-17-13(15-12)10-5-3-2-4-6-10/h2-8H,1H3.
What are the key properties of 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole?
5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole has a molecular weight of 242.30 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-(2-phenyl-1,3-thiazol-4-yl)-1,2-oxazole is sourced from PubChem (CID 1479634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).