C53H65FN2O6Si — CID 147974062
benzyl N-[(2S,9S)-1-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecan-2-yl]-N-(3-methylbutyl)carbamate (PubChem CID 147974062) has the molecular formula C53H65FN2O6Si and a molecular weight of 873.20 g/mol. Its IUPAC name is benzyl N-[(2S,9S)-1-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecan-2-yl]-N-(3-methylbutyl)carbamate.
| Compound Name | benzyl N-[(2S,9S)-1-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecan-2-yl]-N-(3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 147974062 |
| Molecular Formula | C53H65FN2O6Si |
| Molecular Weight | 873.20 g/mol |
| Exact Mass | 872.46 |
| IUPAC Name | benzyl N-[(2S,9S)-1-[tert-butyl(diphenyl)silyl]oxy-5-fluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecan-2-yl]-N-(3-methylbutyl)carbamate |
| SMILES | COC(=O)N[C@H](C(=O)CCC(F)CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(CCC(C)C)C(=O)OCc1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H65FN2O6Si/c1-40(2)36-37-56(52(59)61-38-41-22-12-7-13-23-41)45(39-62-63(53(3,4)5,46-28-18-10-19-29-46)47-30-20-11-21-31-47)34-32-44(54)33-35-48(57)50(55-51(58)60-6)49(42-24-14-8-15-25-42)43-26-16-9-17-27-43/h7-31,40,44-45,49-50H,32-39H2,1-6H3,(H,55,58)/t44?,45-,50+/m0/s1 |
| InChIKey | IRXVUZHSKRXVFZ-HIJGHIPXSA-N |
| XLogP | 10.64 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.20 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|