C58H42GeN4 — CID 147974428
[3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methylcarbazol-9-yl)phenyl]phenyl]-triphenylgermane (PubChem CID 147974428) has the molecular formula C58H42GeN4 and a molecular weight of 867.61 g/mol. Its IUPAC name is [3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methylcarbazol-9-yl)phenyl]phenyl]-triphenylgermane.
| Compound Name | [3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methylcarbazol-9-yl)phenyl]phenyl]-triphenylgermane |
|---|---|
| PubChem CID | 147974428 |
| Molecular Formula | C58H42GeN4 |
| Molecular Weight | 867.61 g/mol |
| Exact Mass | 868.26 |
| IUPAC Name | [3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methylcarbazol-9-yl)phenyl]phenyl]-triphenylgermane |
| SMILES | Cc1ccc2c(c1)c1ccccc1n2-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2cccc([Ge](c3ccccc3)(c3ccccc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C58H42GeN4/c1-41-34-37-55-53(38-41)50-32-17-18-33-54(50)63(55)49-35-36-51(58-61-56(42-20-7-2-8-21-42)60-57(62-58)43-22-9-3-10-23-43)52(40-49)44-24-19-31-48(39-44)59(45-25-11-4-12-26-45,46-27-13-5-14-28-46)47-29-15-6-16-30-47/h2-40H,1H3 |
| InChIKey | IRZSSFHNUQFVQC-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.61 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |