About acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate
acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate (PubChem CID 147976056) has the molecular formula C12H15FO5
and a molecular weight of 258.24 g/mol. Its IUPAC name is acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate.
Molecular Properties
| Compound Name | acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate |
| PubChem CID | 147976056 |
| Molecular Formula | C12H15FO5 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate |
| SMILES | COC1C=CC(CC(=O)OCOC(C)=O)=C(F)C1 |
| InChI | InChI=1S/C12H15FO5/c1-8(14)17-7-18-12(15)5-9-3-4-10(16-2)6-11(9)13/h3-4,10H,5-7H2,1-2H3 |
| InChIKey | ISHJPLZCVLEFMZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate?
The IUPAC name of acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate (CID 147976056) is acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate.
What is the SMILES notation for acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate?
The canonical SMILES for acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate is COC1C=CC(CC(=O)OCOC(C)=O)=C(F)C1.
What is the InChIKey of acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate?
The InChIKey is ISHJPLZCVLEFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO5/c1-8(14)17-7-18-12(15)5-9-3-4-10(16-2)6-11(9)13/h3-4,10H,5-7H2,1-2H3.
What are the key properties of acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate?
acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate has a molecular weight of 258.24 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxymethyl 2-(2-fluoro-4-methoxycyclohexa-1,5-dien-1-yl)acetate is sourced from PubChem (CID 147976056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).