About 2-chloro-1,3-thiazole-5-carbaldehyde
2-chloro-1,3-thiazole-5-carbaldehyde (PubChem CID 1479765) has the molecular formula C4H2ClNOS
and a molecular weight of 147.59 g/mol. Its IUPAC name is 2-chloro-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-chloro-1,3-thiazole-5-carbaldehyde |
|---|
| PubChem CID | 1479765 |
|---|
| Molecular Formula | C4H2ClNOS |
|---|
| Molecular Weight | 147.59 g/mol |
|---|
| Exact Mass | 146.95 |
|---|
| IUPAC Name | 2-chloro-1,3-thiazole-5-carbaldehyde |
|---|
| SMILES | O=Cc1cnc(Cl)s1 |
|---|
| InChI | InChI=1S/C4H2ClNOS/c5-4-6-1-3(2-7)8-4/h1-2H |
|---|
| InChIKey | PKCBQQXHFIDIIG-UHFFFAOYSA-N |
|---|
| XLogP | 1.61 |
|---|
| TPSA | 29.96 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 8 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 147.59 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-chloro-1,3-thiazole-5-carbaldehyde (CID 1479765) is 2-chloro-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-chloro-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-chloro-1,3-thiazole-5-carbaldehyde is O=Cc1cnc(Cl)s1.
What is the InChIKey of 2-chloro-1,3-thiazole-5-carbaldehyde?
The InChIKey is PKCBQQXHFIDIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClNOS/c5-4-6-1-3(2-7)8-4/h1-2H.
What are the key properties of 2-chloro-1,3-thiazole-5-carbaldehyde?
2-chloro-1,3-thiazole-5-carbaldehyde has a molecular weight of 147.59 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 1479765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).