About 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile
2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile (PubChem CID 1479766) has the molecular formula C7H2ClN3S
and a molecular weight of 195.63 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile |
| PubChem CID | 1479766 |
| Molecular Formula | C7H2ClN3S |
| Molecular Weight | 195.63 g/mol |
| Exact Mass | 194.97 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H2ClN3S/c8-7-11-4-6(12-7)1-5(2-9)3-10/h1,4H |
| InChIKey | WXPWOOVZWUWAGW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.63 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile (CID 1479766) is 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile is N#CC(C#N)=Cc1cnc(Cl)s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile?
The InChIKey is WXPWOOVZWUWAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClN3S/c8-7-11-4-6(12-7)1-5(2-9)3-10/h1,4H.
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile?
2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile has a molecular weight of 195.63 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)methylidene]propanedinitrile is sourced from PubChem (CID 1479766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).