About 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde
2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde (PubChem CID 1479770) has the molecular formula C8H10N2O2S
and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 1479770 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C8H10N2O2S/c11-6-7-5-9-8(13-7)10-1-3-12-4-2-10/h5-6H,1-4H2 |
| InChIKey | VDZWHWVAMDQEBT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde (CID 1479770) is 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde is O=Cc1cnc(N2CCOCC2)s1.
What is the InChIKey of 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde?
The InChIKey is VDZWHWVAMDQEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c11-6-7-5-9-8(13-7)10-1-3-12-4-2-10/h5-6H,1-4H2.
What are the key properties of 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde?
2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde has a molecular weight of 198.25 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 1479770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).